C19H23FN2O3S — CID 113138770
N-[(2-fluorophenyl)methyl]-3-[(2-methylphenyl)methyl-methylsulfonylamino]propanamide (PubChem CID 113138770) has the molecular formula C19H23FN2O3S and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-[(2-methylphenyl)methyl-methylsulfonylamino]propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-[(2-methylphenyl)methyl-methylsulfonylamino]propanamide |
|---|---|
| PubChem CID | 113138770 |
| Molecular Formula | C19H23FN2O3S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-[(2-methylphenyl)methyl-methylsulfonylamino]propanamide |
| SMILES | Cc1ccccc1CN(CCC(=O)NCc1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C19H23FN2O3S/c1-15-7-3-4-9-17(15)14-22(26(2,24)25)12-11-19(23)21-13-16-8-5-6-10-18(16)20/h3-10H,11-14H2,1-2H3,(H,21,23) |
| InChIKey | YDAHGFAQXJABEB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |