C18H27N3O3S — CID 113140591
N-tert-butyl-3-[2-(1H-indol-3-yl)ethyl-methylsulfonylamino]propanamide (PubChem CID 113140591) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-tert-butyl-3-[2-(1H-indol-3-yl)ethyl-methylsulfonylamino]propanamide.
| Compound Name | N-tert-butyl-3-[2-(1H-indol-3-yl)ethyl-methylsulfonylamino]propanamide |
|---|---|
| PubChem CID | 113140591 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-tert-butyl-3-[2-(1H-indol-3-yl)ethyl-methylsulfonylamino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCN(CCc1c[nH]c2ccccc12)S(C)(=O)=O |
| InChI | InChI=1S/C18H27N3O3S/c1-18(2,3)20-17(22)10-12-21(25(4,23)24)11-9-14-13-19-16-8-6-5-7-15(14)16/h5-8,13,19H,9-12H2,1-4H3,(H,20,22) |
| InChIKey | IMTQSIJECURNDF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |