C16H31N3O5S — CID 113140682
ethyl 4-[[3-(diethylamino)-3-oxopropyl]-methylsulfonylamino]piperidine-1-carboxylate (PubChem CID 113140682) has the molecular formula C16H31N3O5S and a molecular weight of 377.51 g/mol. Its IUPAC name is ethyl 4-[[3-(diethylamino)-3-oxopropyl]-methylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(diethylamino)-3-oxopropyl]-methylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113140682 |
| Molecular Formula | C16H31N3O5S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 4-[[3-(diethylamino)-3-oxopropyl]-methylsulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCC(=O)N(CC)CC)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H31N3O5S/c1-5-17(6-2)15(20)10-13-19(25(4,22)23)14-8-11-18(12-9-14)16(21)24-7-3/h14H,5-13H2,1-4H3 |
| InChIKey | PJRAJVBGZYEFQH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |