C17H18N2O5S — CID 113141566
N-(1,3-benzodioxol-5-yl)-3-(N-methylsulfonylanilino)propanamide (PubChem CID 113141566) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(N-methylsulfonylanilino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113141566 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(N-methylsulfonylanilino)propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)Nc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-25(21,22)19(14-5-3-2-4-6-14)10-9-17(20)18-13-7-8-15-16(11-13)24-12-23-15/h2-8,11H,9-10,12H2,1H3,(H,18,20) |
| InChIKey | QBVGJTKMUKLQJO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |