C20H32O5 — CID 11314163
[(2Z,4R,5S,6S)-6-methoxy-5-(methoxymethoxy)-2,4-dimethylocta-2,7-dienyl] (2E)-hepta-2,6-dienoate (PubChem CID 11314163) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(2Z,4R,5S,6S)-6-methoxy-5-(methoxymethoxy)-2,4-dimethylocta-2,7-dienyl] (2E)-hepta-2,6-dienoate.
| Compound Name | [(2Z,4R,5S,6S)-6-methoxy-5-(methoxymethoxy)-2,4-dimethylocta-2,7-dienyl] (2E)-hepta-2,6-dienoate |
|---|---|
| PubChem CID | 11314163 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(2Z,4R,5S,6S)-6-methoxy-5-(methoxymethoxy)-2,4-dimethylocta-2,7-dienyl] (2E)-hepta-2,6-dienoate |
| SMILES | C=CCC/C=C/C(=O)OC/C(C)=C\[C@@H](C)[C@H](OCOC)[C@H](C=C)OC |
| InChI | InChI=1S/C20H32O5/c1-7-9-10-11-12-19(21)24-14-16(3)13-17(4)20(25-15-22-5)18(8-2)23-6/h7-8,11-13,17-18,20H,1-2,9-10,14-15H2,3-6H3/b12-11+,16-13-/t17-,18+,20+/m1/s1 |
| InChIKey | JHQAAVXENGWZNL-JTAGDPKKSA-N |
| XLogP | 3.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|