About 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride
2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride (PubChem CID 11314197) has the molecular formula C19H28ClNO3
and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 11314197 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCOCC1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H27NO3.ClH/c21-18(23-16-13-20-11-14-22-15-12-20)19(9-5-2-6-10-19)17-7-3-1-4-8-17;/h1,3-4,7-8H,2,5-6,9-16H2;1H |
| InChIKey | QUJWFJNHTBKCLU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride (CID 11314197) is 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride is Cl.O=C(OCCN1CCOCC1)C1(c2ccccc2)CCCCC1.
What is the InChIKey of 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride?
The InChIKey is QUJWFJNHTBKCLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3.ClH/c21-18(23-16-13-20-11-14-22-15-12-20)19(9-5-2-6-10-19)17-7-3-1-4-8-17;/h1,3-4,7-8H,2,5-6,9-16H2;1H.
What are the key properties of 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride?
2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride has a molecular weight of 353.89 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 11314197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).