C16H26N2O3S — CID 113142055
N-tert-butyl-3-(2,4-dimethyl-N-methylsulfonylanilino)propanamide (PubChem CID 113142055) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-tert-butyl-3-(2,4-dimethyl-N-methylsulfonylanilino)propanamide.
| Compound Name | N-tert-butyl-3-(2,4-dimethyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113142055 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-tert-butyl-3-(2,4-dimethyl-N-methylsulfonylanilino)propanamide |
| SMILES | Cc1ccc(N(CCC(=O)NC(C)(C)C)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C16H26N2O3S/c1-12-7-8-14(13(2)11-12)18(22(6,20)21)10-9-15(19)17-16(3,4)5/h7-8,11H,9-10H2,1-6H3,(H,17,19) |
| InChIKey | CLOWPIDWQSLFBX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |