C19H25F3N2O — CID 11314216
N-[(1-benzyl-3-butyl-2,6-dihydropyridin-3-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 11314216) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[(1-benzyl-3-butyl-2,6-dihydropyridin-3-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1-benzyl-3-butyl-2,6-dihydropyridin-3-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11314216 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[(1-benzyl-3-butyl-2,6-dihydropyridin-3-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCC1(CNC(=O)C(F)(F)F)C=CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25F3N2O/c1-2-3-10-18(14-23-17(25)19(20,21)22)11-7-12-24(15-18)13-16-8-5-4-6-9-16/h4-9,11H,2-3,10,12-15H2,1H3,(H,23,25) |
| InChIKey | SVXHRIXAAHYVCB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|