C20H23N3O3S — CID 113142957
N-(2-cyanophenyl)-3-(2-ethyl-6-methyl-N-methylsulfonylanilino)propanamide (PubChem CID 113142957) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(2-cyanophenyl)-3-(2-ethyl-6-methyl-N-methylsulfonylanilino)propanamide.
| Compound Name | N-(2-cyanophenyl)-3-(2-ethyl-6-methyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113142957 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(2-cyanophenyl)-3-(2-ethyl-6-methyl-N-methylsulfonylanilino)propanamide |
| SMILES | CCc1cccc(C)c1N(CCC(=O)Nc1ccccc1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C20H23N3O3S/c1-4-16-10-7-8-15(2)20(16)23(27(3,25)26)13-12-19(24)22-18-11-6-5-9-17(18)14-21/h5-11H,4,12-13H2,1-3H3,(H,22,24) |
| InChIKey | GBLQRQVYTFBITL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |