About N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide
N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide (PubChem CID 11314302) has the molecular formula C21H25ClN2O
and a molecular weight of 356.90 g/mol. Its IUPAC name is N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide |
| PubChem CID | 11314302 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25ClN2O/c1-24-12-11-20(17-7-9-19(22)10-8-17)18(15-24)13-21(25)23-14-16-5-3-2-4-6-16/h2-10,18,20H,11-15H2,1H3,(H,23,25)/t18-,20+/m0/s1 |
| InChIKey | JVZFUFCDIAOQJH-AZUAARDMSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide?
The IUPAC name of N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide (CID 11314302) is N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide.
What is the SMILES notation for N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide?
The canonical SMILES for N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide is CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CC(=O)NCc2ccccc2)C1.
What is the InChIKey of N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide?
The InChIKey is JVZFUFCDIAOQJH-AZUAARDMSA-N. The full InChI is InChI=1S/C21H25ClN2O/c1-24-12-11-20(17-7-9-19(22)10-8-17)18(15-24)13-21(25)23-14-16-5-3-2-4-6-16/h2-10,18,20H,11-15H2,1H3,(H,23,25)/t18-,20+/m0/s1.
What are the key properties of N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide?
N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide has a molecular weight of 356.90 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetamide is sourced from PubChem (CID 11314302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).