C22H30O4 — CID 11314343
ethyl (2R,3R,6R)-6-cyclohexyl-4-oxo-2-(2-phenylethyl)oxane-3-carboxylate (PubChem CID 11314343) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is ethyl (2R,3R,6R)-6-cyclohexyl-4-oxo-2-(2-phenylethyl)oxane-3-carboxylate.
| Compound Name | ethyl (2R,3R,6R)-6-cyclohexyl-4-oxo-2-(2-phenylethyl)oxane-3-carboxylate |
|---|---|
| PubChem CID | 11314343 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | ethyl (2R,3R,6R)-6-cyclohexyl-4-oxo-2-(2-phenylethyl)oxane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C[C@H](C2CCCCC2)O[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C22H30O4/c1-2-25-22(24)21-18(23)15-20(17-11-7-4-8-12-17)26-19(21)14-13-16-9-5-3-6-10-16/h3,5-6,9-10,17,19-21H,2,4,7-8,11-15H2,1H3/t19-,20-,21+/m1/s1 |
| InChIKey | WYQPHMJCKUIMRD-NJYVYQBISA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|