C16H21F3N2O3S — CID 113145276
N-cyclopentyl-3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]propanamide (PubChem CID 113145276) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is N-cyclopentyl-3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-cyclopentyl-3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 113145276 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-cyclopentyl-3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)NC1CCCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O3S/c1-25(23,24)21(11-10-15(22)20-13-4-2-3-5-13)14-8-6-12(7-9-14)16(17,18)19/h6-9,13H,2-5,10-11H2,1H3,(H,20,22) |
| InChIKey | AJFUATNOJOEZPA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |