C19H27NO4S — CID 11314547
methyl 2-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate (PubChem CID 11314547) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl 2-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | methyl 2-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 11314547 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl 2-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC2(CCCCC2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO4S/c1-15-7-9-16(10-8-15)25(22,23)20-18(2,17(21)24-3)13-14-19(20)11-5-4-6-12-19/h7-10H,4-6,11-14H2,1-3H3 |
| InChIKey | XLFSGEKKURZWGA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |