C18H14N4O3S — CID 11314577
4-(3-cyanoanilino)-6-methylsulfonylquinoline-3-carboxamide (PubChem CID 11314577) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-(3-cyanoanilino)-6-methylsulfonylquinoline-3-carboxamide.
| Compound Name | 4-(3-cyanoanilino)-6-methylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11314577 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 4-(3-cyanoanilino)-6-methylsulfonylquinoline-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2ncc(C(N)=O)c(Nc3cccc(C#N)c3)c2c1 |
| InChI | InChI=1S/C18H14N4O3S/c1-26(24,25)13-5-6-16-14(8-13)17(15(10-21-16)18(20)23)22-12-4-2-3-11(7-12)9-19/h2-8,10H,1H3,(H2,20,23)(H,21,22) |
| InChIKey | MXGXXUDJDPPFAZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |