C17H23N3O3S — CID 113146267
N,N-diethyl-3-[methylsulfonyl(quinolin-8-yl)amino]propanamide (PubChem CID 113146267) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N,N-diethyl-3-[methylsulfonyl(quinolin-8-yl)amino]propanamide.
| Compound Name | N,N-diethyl-3-[methylsulfonyl(quinolin-8-yl)amino]propanamide |
|---|---|
| PubChem CID | 113146267 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N,N-diethyl-3-[methylsulfonyl(quinolin-8-yl)amino]propanamide |
| SMILES | CCN(CC)C(=O)CCN(c1cccc2cccnc12)S(C)(=O)=O |
| InChI | InChI=1S/C17H23N3O3S/c1-4-19(5-2)16(21)11-13-20(24(3,22)23)15-10-6-8-14-9-7-12-18-17(14)15/h6-10,12H,4-5,11,13H2,1-3H3 |
| InChIKey | FFJSXLCVKLCVTQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |