C14H20F2N2O3S — CID 113146327
N-butyl-3-(2,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 113146327) has the molecular formula C14H20F2N2O3S and a molecular weight of 334.39 g/mol. Its IUPAC name is N-butyl-3-(2,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-butyl-3-(2,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113146327 |
| Molecular Formula | C14H20F2N2O3S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-butyl-3-(2,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CCCCNC(=O)CCN(c1ccc(F)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H20F2N2O3S/c1-3-4-8-17-14(19)7-9-18(22(2,20)21)13-6-5-11(15)10-12(13)16/h5-6,10H,3-4,7-9H2,1-2H3,(H,17,19) |
| InChIKey | QTFROIJGHQUDPD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|