C18H12F5NO2 — CID 11314671
[(E)-1-(2-prop-2-enylphenyl)ethylideneamino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 11314671) has the molecular formula C18H12F5NO2 and a molecular weight of 369.29 g/mol. Its IUPAC name is [(E)-1-(2-prop-2-enylphenyl)ethylideneamino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(E)-1-(2-prop-2-enylphenyl)ethylideneamino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 11314671 |
| Molecular Formula | C18H12F5NO2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(E)-1-(2-prop-2-enylphenyl)ethylideneamino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=CCc1ccccc1/C(C)=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H12F5NO2/c1-3-6-10-7-4-5-8-11(10)9(2)24-26-18(25)12-13(19)15(21)17(23)16(22)14(12)20/h3-5,7-8H,1,6H2,2H3/b24-9+ |
| InChIKey | CAPGAUJGHUYYKE-PGGKNCGUSA-N |
| XLogP | 4.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|