C16H22N4O3S — CID 113146833
N-(3-cyanophenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide (PubChem CID 113146833) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide.
| Compound Name | N-(3-cyanophenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 113146833 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(3-cyanophenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
| SMILES | CN1CCN(C(=O)CCN(c2cccc(C#N)c2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H22N4O3S/c1-18-8-10-19(11-9-18)16(21)6-7-20(24(2,22)23)15-5-3-4-14(12-15)13-17/h3-5,12H,6-11H2,1-2H3 |
| InChIKey | VOBPHDVSKMOYGX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |