C18H20F2N2O3S — CID 113147158
3-(2,6-difluoro-N-methylsulfonylanilino)-N-(2,5-dimethylphenyl)propanamide (PubChem CID 113147158) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is 3-(2,6-difluoro-N-methylsulfonylanilino)-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 3-(2,6-difluoro-N-methylsulfonylanilino)-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 113147158 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-(2,6-difluoro-N-methylsulfonylanilino)-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCN(c2c(F)cccc2F)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H20F2N2O3S/c1-12-7-8-13(2)16(11-12)21-17(23)9-10-22(26(3,24)25)18-14(19)5-4-6-15(18)20/h4-8,11H,9-10H2,1-3H3,(H,21,23) |
| InChIKey | FUQNAHOKUWSFFP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |