C13H24N4O4S — CID 113147313
N-[3-(dimethylamino)propyl]-3-[(5-methyl-1,2-oxazol-3-yl)-methylsulfonylamino]propanamide (PubChem CID 113147313) has the molecular formula C13H24N4O4S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[(5-methyl-1,2-oxazol-3-yl)-methylsulfonylamino]propanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[(5-methyl-1,2-oxazol-3-yl)-methylsulfonylamino]propanamide |
|---|---|
| PubChem CID | 113147313 |
| Molecular Formula | C13H24N4O4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[(5-methyl-1,2-oxazol-3-yl)-methylsulfonylamino]propanamide |
| SMILES | Cc1cc(N(CCC(=O)NCCCN(C)C)S(C)(=O)=O)no1 |
| InChI | InChI=1S/C13H24N4O4S/c1-11-10-12(15-21-11)17(22(4,19)20)9-6-13(18)14-7-5-8-16(2)3/h10H,5-9H2,1-4H3,(H,14,18) |
| InChIKey | ZYJGIXNGVAMNOU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|