C14H27N3O5S — CID 113147705
ethyl 4-[[2-[methylsulfonyl(propan-2-yl)amino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 113147705) has the molecular formula C14H27N3O5S and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl 4-[[2-[methylsulfonyl(propan-2-yl)amino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[methylsulfonyl(propan-2-yl)amino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113147705 |
| Molecular Formula | C14H27N3O5S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl 4-[[2-[methylsulfonyl(propan-2-yl)amino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CN(C(C)C)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H27N3O5S/c1-5-22-14(19)16-8-6-12(7-9-16)15-13(18)10-17(11(2)3)23(4,20)21/h11-12H,5-10H2,1-4H3,(H,15,18) |
| InChIKey | GMOYYSPHHOOPMC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |