C10H20N2O3S — CID 113147914
2-[cyclopropyl(methylsulfonyl)amino]-N,N-diethylacetamide (PubChem CID 113147914) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[cyclopropyl(methylsulfonyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[cyclopropyl(methylsulfonyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 113147914 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[cyclopropyl(methylsulfonyl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C10H20N2O3S/c1-4-11(5-2)10(13)8-12(9-6-7-9)16(3,14)15/h9H,4-8H2,1-3H3 |
| InChIKey | VSWWQHJPDDRUID-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |