C14H19ClN2O4S — CID 113148226
N-(4-chloro-2-methoxy-5-methylphenyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide (PubChem CID 113148226) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 113148226 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1cc(C)c(Cl)cc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C14H19ClN2O4S/c1-5-6-17(22(4,19)20)9-14(18)16-12-7-10(2)11(15)8-13(12)21-3/h5,7-8H,1,6,9H2,2-4H3,(H,16,18) |
| InChIKey | MCFJEHMFHAFLTE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|