C22H30O5 — CID 11314823
methyl (1'R,2'R,6'S,7'R)-5,5-dimethyl-12'-oxo-10'-prop-1-en-2-ylspiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate (PubChem CID 11314823) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (1'R,2'R,6'S,7'R)-5,5-dimethyl-12'-oxo-10'-prop-1-en-2-ylspiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'R,6'S,7'R)-5,5-dimethyl-12'-oxo-10'-prop-1-en-2-ylspiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate |
|---|---|
| PubChem CID | 11314823 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (1'R,2'R,6'S,7'R)-5,5-dimethyl-12'-oxo-10'-prop-1-en-2-ylspiro[1,3-dioxane-2,4'-tricyclo[5.4.1.02,6]dodec-9-ene]-1'-carboxylate |
| SMILES | C=C(C)C1=CC[C@H]2C(=O)[C@@](C(=O)OC)(C1)[C@@H]1CC3(C[C@@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C22H30O5/c1-13(2)14-6-7-15-16-9-21(26-11-20(3,4)12-27-21)10-17(16)22(8-14,18(15)23)19(24)25-5/h6,15-17H,1,7-12H2,2-5H3/t15-,16-,17-,22-/m1/s1 |
| InChIKey | IHOLJMVIFKDLIP-PEOGOYOCSA-N |
| XLogP | 3.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|