C15H29N3O5S — CID 113148297
ethyl 4-[[2-[butyl(methylsulfonyl)amino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 113148297) has the molecular formula C15H29N3O5S and a molecular weight of 363.48 g/mol. Its IUPAC name is ethyl 4-[[2-[butyl(methylsulfonyl)amino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[butyl(methylsulfonyl)amino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113148297 |
| Molecular Formula | C15H29N3O5S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | ethyl 4-[[2-[butyl(methylsulfonyl)amino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCN(CC(=O)NC1CCN(C(=O)OCC)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H29N3O5S/c1-4-6-9-18(24(3,21)22)12-14(19)16-13-7-10-17(11-8-13)15(20)23-5-2/h13H,4-12H2,1-3H3,(H,16,19) |
| InChIKey | ZMKCVBHAARZJFZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |