C15H27N3O5S — CID 113148885
ethyl 4-[2-[cyclopentyl(methylsulfonyl)amino]acetyl]piperazine-1-carboxylate (PubChem CID 113148885) has the molecular formula C15H27N3O5S and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl 4-[2-[cyclopentyl(methylsulfonyl)amino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[cyclopentyl(methylsulfonyl)amino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113148885 |
| Molecular Formula | C15H27N3O5S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl 4-[2-[cyclopentyl(methylsulfonyl)amino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN(C2CCCC2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H27N3O5S/c1-3-23-15(20)17-10-8-16(9-11-17)14(19)12-18(24(2,21)22)13-6-4-5-7-13/h13H,3-12H2,1-2H3 |
| InChIKey | FZYQWPVWAXRZKF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |