C15H19F3N2O3S — CID 113148963
2-[cyclopentyl(methylsulfonyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 113148963) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-[cyclopentyl(methylsulfonyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[cyclopentyl(methylsulfonyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113148963 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[cyclopentyl(methylsulfonyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(C(F)(F)F)c1)C1CCCC1 |
| InChI | InChI=1S/C15H19F3N2O3S/c1-24(22,23)20(13-7-2-3-8-13)10-14(21)19-12-6-4-5-11(9-12)15(16,17)18/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,19,21) |
| InChIKey | SEJIASWPIUOJGI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |