C14H26N2O6S — CID 113149469
N-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-N-(3-methoxypropyl)methanesulfonamide (PubChem CID 113149469) has the molecular formula C14H26N2O6S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-N-(3-methoxypropyl)methanesulfonamide.
| Compound Name | N-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-N-(3-methoxypropyl)methanesulfonamide |
|---|---|
| PubChem CID | 113149469 |
| Molecular Formula | C14H26N2O6S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-N-(3-methoxypropyl)methanesulfonamide |
| SMILES | COCCCN(CC(=O)N1CCC2(CC1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C14H26N2O6S/c1-20-9-3-6-16(23(2,18)19)12-13(17)15-7-4-14(5-8-15)21-10-11-22-14/h3-12H2,1-2H3 |
| InChIKey | PUDOYLNBJAFNIZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|