C15H24N2O4S — CID 113149508
N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]-N-phenylacetamide (PubChem CID 113149508) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]-N-phenylacetamide.
| Compound Name | N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 113149508 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]-N-phenylacetamide |
| SMILES | CCN(C(=O)CN(CCCOC)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O4S/c1-4-17(14-9-6-5-7-10-14)15(18)13-16(22(3,19)20)11-8-12-21-2/h5-7,9-10H,4,8,11-13H2,1-3H3 |
| InChIKey | UCVMJOLQMOIGAT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|