C15H25N3O4S — CID 113149554
N-[4-(dimethylamino)phenyl]-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide (PubChem CID 113149554) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113149554 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1ccc(N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H25N3O4S/c1-17(2)14-8-6-13(7-9-14)16-15(19)12-18(23(4,20)21)10-5-11-22-3/h6-9H,5,10-12H2,1-4H3,(H,16,19) |
| InChIKey | RRUUVLAAXDFEQA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|