About N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide
N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide (PubChem CID 11314966) has the molecular formula C16H11F6NO3
and a molecular weight of 379.26 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide |
| PubChem CID | 11314966 |
| Molecular Formula | C16H11F6NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H11F6NO3/c1-26-11-2-3-13(24)12(7-11)14(25)23-10-5-8(15(17,18)19)4-9(6-10)16(20,21)22/h2-7,24H,1H3,(H,23,25) |
| InChIKey | FYBGLYVXXGYEGQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide (CID 11314966) is N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide is COc1ccc(O)c(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide?
The InChIKey is FYBGLYVXXGYEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F6NO3/c1-26-11-2-3-13(24)12(7-11)14(25)23-10-5-8(15(17,18)19)4-9(6-10)16(20,21)22/h2-7,24H,1H3,(H,23,25).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide?
N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide has a molecular weight of 379.26 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methoxybenzamide is sourced from PubChem (CID 11314966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).