C12H27N3O3S — CID 113150085
N-butan-2-yl-2-[3-(dimethylamino)propyl-methylsulfonylamino]acetamide (PubChem CID 113150085) has the molecular formula C12H27N3O3S and a molecular weight of 293.43 g/mol. Its IUPAC name is N-butan-2-yl-2-[3-(dimethylamino)propyl-methylsulfonylamino]acetamide.
| Compound Name | N-butan-2-yl-2-[3-(dimethylamino)propyl-methylsulfonylamino]acetamide |
|---|---|
| PubChem CID | 113150085 |
| Molecular Formula | C12H27N3O3S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-butan-2-yl-2-[3-(dimethylamino)propyl-methylsulfonylamino]acetamide |
| SMILES | CCC(C)NC(=O)CN(CCCN(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C12H27N3O3S/c1-6-11(2)13-12(16)10-15(19(5,17)18)9-7-8-14(3)4/h11H,6-10H2,1-5H3,(H,13,16) |
| InChIKey | ZHAPJLNOKLNYND-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |