C16H26N2O3S — CID 113150859
N-(3-methylbutyl)-2-[methylsulfonyl(1-phenylethyl)amino]acetamide (PubChem CID 113150859) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[methylsulfonyl(1-phenylethyl)amino]acetamide.
| Compound Name | N-(3-methylbutyl)-2-[methylsulfonyl(1-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 113150859 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(3-methylbutyl)-2-[methylsulfonyl(1-phenylethyl)amino]acetamide |
| SMILES | CC(C)CCNC(=O)CN(C(C)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O3S/c1-13(2)10-11-17-16(19)12-18(22(4,20)21)14(3)15-8-6-5-7-9-15/h5-9,13-14H,10-12H2,1-4H3,(H,17,19) |
| InChIKey | NUJVPAGVGGWHNL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |