C18H21FN2O4S — CID 113151047
N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methyl-methylsulfonylamino]acetamide (PubChem CID 113151047) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methyl-methylsulfonylamino]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methyl-methylsulfonylamino]acetamide |
|---|---|
| PubChem CID | 113151047 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(4-fluorophenyl)methyl-methylsulfonylamino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CN(Cc2ccc(F)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21FN2O4S/c1-3-25-17-10-8-16(9-11-17)20-18(22)13-21(26(2,23)24)12-14-4-6-15(19)7-5-14/h4-11H,3,12-13H2,1-2H3,(H,20,22) |
| InChIKey | BXUWIQGFWBLRRE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |