C19H31N3O4S — CID 113153244
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-methylbutyl)methanesulfonamide (PubChem CID 113153244) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-methylbutyl)methanesulfonamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-methylbutyl)methanesulfonamide |
|---|---|
| PubChem CID | 113153244 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-methylbutyl)methanesulfonamide |
| SMILES | COc1ccccc1N1CCN(C(=O)CN(CCC(C)C)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H31N3O4S/c1-16(2)9-10-22(27(4,24)25)15-19(23)21-13-11-20(12-14-21)17-7-5-6-8-18(17)26-3/h5-8,16H,9-15H2,1-4H3 |
| InChIKey | PDKLOEFRVABVSE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |