C19H30N2O5S — CID 113153433
N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylmethanesulfonamide (PubChem CID 113153433) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylmethanesulfonamide.
| Compound Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylmethanesulfonamide |
|---|---|
| PubChem CID | 113153433 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylmethanesulfonamide |
| SMILES | CCCCCN(CC(=O)N1CCc2cc(OC)c(OC)cc2C1)S(C)(=O)=O |
| InChI | InChI=1S/C19H30N2O5S/c1-5-6-7-9-21(27(4,23)24)14-19(22)20-10-8-15-11-17(25-2)18(26-3)12-16(15)13-20/h11-12H,5-10,13-14H2,1-4H3 |
| InChIKey | VYCGZBPJQGTOLI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|