C14H21FN2O3S — CID 113153470
N-(2-fluorophenyl)-2-[methylsulfonyl(pentyl)amino]acetamide (PubChem CID 113153470) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[methylsulfonyl(pentyl)amino]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[methylsulfonyl(pentyl)amino]acetamide |
|---|---|
| PubChem CID | 113153470 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(2-fluorophenyl)-2-[methylsulfonyl(pentyl)amino]acetamide |
| SMILES | CCCCCN(CC(=O)Nc1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H21FN2O3S/c1-3-4-7-10-17(21(2,19)20)11-14(18)16-13-9-6-5-8-12(13)15/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,16,18) |
| InChIKey | ZRNCLCSTIZBPDR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|