C20H20ClN7 — CID 11315381
12-[(3S)-3-aminopyrrolidin-1-yl]-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 11315381) has the molecular formula C20H20ClN7 and a molecular weight of 393.88 g/mol. Its IUPAC name is 12-[(3S)-3-aminopyrrolidin-1-yl]-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | 12-[(3S)-3-aminopyrrolidin-1-yl]-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 11315381 |
| Molecular Formula | C20H20ClN7 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 12-[(3S)-3-aminopyrrolidin-1-yl]-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CC[C@H](N)C3)nc2n2cncc12 |
| InChI | InChI=1S/C20H20ClN7/c1-12-3-2-4-14(21)18(12)26-19-16-9-23-11-28(16)20-15(24-19)5-6-17(25-20)27-8-7-13(22)10-27/h2-6,9,11,13H,7-8,10,22H2,1H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | NNGYALDRCGUUJY-ZDUSSCGKSA-N |
| XLogP | 3.52 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |