C14H22N2O3S — CID 113154143
2-(4-ethyl-N-methylsulfonylanilino)-N-propan-2-ylacetamide (PubChem CID 113154143) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(4-ethyl-N-methylsulfonylanilino)-N-propan-2-ylacetamide.
| Compound Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 113154143 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-propan-2-ylacetamide |
| SMILES | CCc1ccc(N(CC(=O)NC(C)C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-5-12-6-8-13(9-7-12)16(20(4,18)19)10-14(17)15-11(2)3/h6-9,11H,5,10H2,1-4H3,(H,15,17) |
| InChIKey | AKIALTJXAZAIEL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |