C20H23N5O4 — CID 11315470
(2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-ethylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11315470) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-ethylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-ethylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11315470 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-ethylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCc1nc2c(N3CCc4ccccc43)ncnc2n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H23N5O4/c1-2-14-23-15-18(24-8-7-11-5-3-4-6-12(11)24)21-10-22-19(15)25(14)20-17(28)16(27)13(9-26)29-20/h3-6,10,13,16-17,20,26-28H,2,7-9H2,1H3/t13-,16-,17-,20-/m1/s1 |
| InChIKey | FMFDRPKHXVALRT-AEVYOOLXSA-N |
| XLogP | 0.69 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |