About (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide
(2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide (PubChem CID 11315473) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide |
| PubChem CID | 11315473 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCC[C@H](NC(=O)c1ccccc1)C(=O)NCc1ccccc1)NO |
| InChI | InChI=1S/C22H27N3O4/c26-20(25-29)15-9-3-8-14-19(24-21(27)18-12-6-2-7-13-18)22(28)23-16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19,29H,3,8-9,14-16H2,(H,23,28)(H,24,27)(H,25,26)/t19-/m0/s1 |
| InChIKey | HQEGOBBCQUNPMY-IBGZPJMESA-N |
| XLogP | 2.56 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide?
The IUPAC name of (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide (CID 11315473) is (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide.
What is the SMILES notation for (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide?
The canonical SMILES for (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide is O=C(CCCCC[C@H](NC(=O)c1ccccc1)C(=O)NCc1ccccc1)NO.
What is the InChIKey of (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide?
The InChIKey is HQEGOBBCQUNPMY-IBGZPJMESA-N. The full InChI is InChI=1S/C22H27N3O4/c26-20(25-29)15-9-3-8-14-19(24-21(27)18-12-6-2-7-13-18)22(28)23-16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19,29H,3,8-9,14-16H2,(H,23,28)(H,24,27)(H,25,26)/t19-/m0/s1.
What are the key properties of (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide?
(2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide has a molecular weight of 397.48 g/mol, XLogP of 2.56, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzamido-N-benzyl-N'-hydroxyoctanediamide is sourced from PubChem (CID 11315473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).