C26H41NO2 — CID 11315542
(2R)-2-ethyl-N-[(4R,5R)-4-ethyl-5-phenylmethoxydec-9-enyl]pent-4-enamide (PubChem CID 11315542) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (2R)-2-ethyl-N-[(4R,5R)-4-ethyl-5-phenylmethoxydec-9-enyl]pent-4-enamide.
| Compound Name | (2R)-2-ethyl-N-[(4R,5R)-4-ethyl-5-phenylmethoxydec-9-enyl]pent-4-enamide |
|---|---|
| PubChem CID | 11315542 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (2R)-2-ethyl-N-[(4R,5R)-4-ethyl-5-phenylmethoxydec-9-enyl]pent-4-enamide |
| SMILES | C=CCCC[C@@H](OCc1ccccc1)[C@H](CC)CCCNC(=O)[C@H](CC)CC=C |
| InChI | InChI=1S/C26H41NO2/c1-5-9-11-19-25(29-21-22-16-12-10-13-17-22)23(7-3)18-14-20-27-26(28)24(8-4)15-6-2/h5-6,10,12-13,16-17,23-25H,1-2,7-9,11,14-15,18-21H2,3-4H3,(H,27,28)/t23-,24-,25-/m1/s1 |
| InChIKey | JDRJRDHXZRJWFS-UBFVSLLYSA-N |
| XLogP | 6.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|