C16H23N3O3S — CID 113156254
2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)-N-prop-2-enylacetamide (PubChem CID 113156254) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)-N-prop-2-enylacetamide.
| Compound Name | 2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 113156254 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(c1ccc(N2CCCC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H23N3O3S/c1-3-10-17-16(20)13-19(23(2,21)22)15-8-6-14(7-9-15)18-11-4-5-12-18/h3,6-9H,1,4-5,10-13H2,2H3,(H,17,20) |
| InChIKey | MRLIUBMQLMXVMB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|