C20H34N2O3S — CID 113156608
2-[N-methylsulfonyl-2,6-di(propan-2-yl)anilino]-N-pentylacetamide (PubChem CID 113156608) has the molecular formula C20H34N2O3S and a molecular weight of 382.57 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-2,6-di(propan-2-yl)anilino]-N-pentylacetamide.
| Compound Name | 2-[N-methylsulfonyl-2,6-di(propan-2-yl)anilino]-N-pentylacetamide |
|---|---|
| PubChem CID | 113156608 |
| Molecular Formula | C20H34N2O3S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-[N-methylsulfonyl-2,6-di(propan-2-yl)anilino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(c1c(C(C)C)cccc1C(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C20H34N2O3S/c1-7-8-9-13-21-19(23)14-22(26(6,24)25)20-17(15(2)3)11-10-12-18(20)16(4)5/h10-12,15-16H,7-9,13-14H2,1-6H3,(H,21,23) |
| InChIKey | RJWARJTVMKHODU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|