C15H18N2O3 — CID 113158573
N-(4-acetylphenyl)-2-[acetyl(prop-2-enyl)amino]acetamide (PubChem CID 113158573) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[acetyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[acetyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 113158573 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(4-acetylphenyl)-2-[acetyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(C(C)=O)cc1)C(C)=O |
| InChI | InChI=1S/C15H18N2O3/c1-4-9-17(12(3)19)10-15(20)16-14-7-5-13(6-8-14)11(2)18/h4-8H,1,9-10H2,2-3H3,(H,16,20) |
| InChIKey | VYAKPUFUVWIEPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|