C19H29N3O2 — CID 113158964
2-[acetyl(2-methylpropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 113158964) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[acetyl(2-methylpropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[acetyl(2-methylpropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 113158964 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-[acetyl(2-methylpropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(N2CCCCC2)cc1)CC(C)C |
| InChI | InChI=1S/C19H29N3O2/c1-15(2)13-22(16(3)23)14-19(24)20-17-7-9-18(10-8-17)21-11-5-4-6-12-21/h7-10,15H,4-6,11-14H2,1-3H3,(H,20,24) |
| InChIKey | PVAQDBXURARZAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|