C22H32N2O4 — CID 113159656
2-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 113159656) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113159656 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN(CCC2=CCCCC2)C(C)=O)cc1OC |
| InChI | InChI=1S/C22H32N2O4/c1-17(25)24(14-12-18-7-5-4-6-8-18)16-22(26)23-13-11-19-9-10-20(27-2)21(15-19)28-3/h7,9-10,15H,4-6,8,11-14,16H2,1-3H3,(H,23,26) |
| InChIKey | NEHFHPRRYDAWAU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|