C25H34O5 — CID 11315966
(3S,4R,5R)-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one (PubChem CID 11315966) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is (3S,4R,5R)-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11315966 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (3S,4R,5R)-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-(2-hydroxy-4-methoxybenzoyl)-4,5-dimethyloxolan-2-one |
| SMILES | COc1ccc(C(=O)[C@H]2C(=O)O[C@](C)(CC/C=C(\C)CCC=C(C)C)[C@@H]2C)c(O)c1 |
| InChI | InChI=1S/C25H34O5/c1-16(2)9-7-10-17(3)11-8-14-25(5)18(4)22(24(28)30-25)23(27)20-13-12-19(29-6)15-21(20)26/h9,11-13,15,18,22,26H,7-8,10,14H2,1-6H3/b17-11+/t18-,22+,25-/m1/s1 |
| InChIKey | KIPSERMYRVHHGN-RYEZDNFWSA-N |
| XLogP | 5.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|