C24H37NO3Si — CID 11315994
N-benzyl-N-[(2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-yl]oxy-2-methylprop-2-enamide (PubChem CID 11315994) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is N-benzyl-N-[(2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-yl]oxy-2-methylprop-2-enamide.
| Compound Name | N-benzyl-N-[(2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-yl]oxy-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 11315994 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-benzyl-N-[(2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-yl]oxy-2-methylprop-2-enamide |
| SMILES | C=C/C(C)=C/[C@H](CO[Si](C)(C)C(C)(C)C)ON(Cc1ccccc1)C(=O)C(=C)C |
| InChI | InChI=1S/C24H37NO3Si/c1-10-20(4)16-22(18-27-29(8,9)24(5,6)7)28-25(23(26)19(2)3)17-21-14-12-11-13-15-21/h10-16,22H,1-2,17-18H2,3-9H3/b20-16+/t22-/m1/s1 |
| InChIKey | TXNLBGOCDRJXQK-QMZMWQIVSA-N |
| XLogP | 6.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|