C20H18F6N2O — CID 11316003
4-[2-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 11316003) has the molecular formula C20H18F6N2O and a molecular weight of 416.37 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 11316003 |
| Molecular Formula | C20H18F6N2O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[2-(trifluoromethyl)phenyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H18F6N2O/c21-19(22,23)14-5-7-15(8-6-14)27-18(29)28-11-9-13(10-12-28)16-3-1-2-4-17(16)20(24,25)26/h1-8,13H,9-12H2,(H,27,29) |
| InChIKey | RGTLOMKJFXXXLB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |